Introduction：Basic information about CAS 5697-00-7|1,4-Naphthalenediol,1,4-diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Naphthalenediol,1,4-diacetate |
|---|
| CAS Number | 5697-00-7 | Molecular Weight | 244.24300 |
|---|
| Density | 1.228g/cm3 | Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.5ºC |
|---|
Names
| Name | (4-acetyloxynaphthalen-1-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.228g/cm3 |
|---|
| Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H12O4 |
|---|
| Molecular Weight | 244.24300 |
|---|
| Flash Point | 195.5ºC |
|---|
| Exact Mass | 244.07400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.69040 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | SFAVMNCWIUOBCX-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c2ccccc12 |
|---|
Synonyms
| 1,4-diacetoxy-naphthalene |
| 1,4-Diacetoxy-naphthalin |
| Naphthalene-1,4-diyl diacetate |
| EINECS 227-172-1 |
| 1,4-Naphthalenediol,diacetate |
