Introduction：Basic information about CAS 29816-55-5|2-nitro-1-p-tolyl-propene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-nitro-1-p-tolyl-propene |
|---|
| CAS Number | 29816-55-5 | Molecular Weight | 177.20000 |
|---|
| Density | 1.112 g/cm3 | Boiling Point | 282.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.9ºC |
|---|
Names
| Name | Toluene, p-(2-nitropropenyl) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.112 g/cm3 |
|---|
| Boiling Point | 282.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO2 |
|---|
| Molecular Weight | 177.20000 |
|---|
| Flash Point | 123.9ºC |
|---|
| Exact Mass | 177.07900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.15570 |
|---|
| Vapour Pressure | 0.00563mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | JEKFDNFWPBWEKO-VQHVLOKHSA-N |
|---|
| SMILES | CC(=Cc1ccc(C)cc1)[N+](=O)[O-] |
|---|
Synonyms
| 4-Metyl-1-phenyl-2-nitropropene |
| 2-Nitro-1-p-tolyl-propen |
| 2-nitro-1-p-tolyl-propene |
| 2-Nitro-1-<4-methyl-phenyl>-prop-1-en |
