Introduction：Basic information about CAS 6324-22-7|N-ethyl-N-(6-methoxyquinolin-8-yl)-N-propan-2-yl-propane-1,3-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-ethyl-N-(6-methoxyquinolin-8-yl)-N-propan-2-yl-propane-1,3-diamine |
|---|
| CAS Number | 6324-22-7 | Molecular Weight | 337.88700 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 454.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H28ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.7ºC |
|---|
Names
| Name | N'-ethyl-N-(6-methoxyquinolin-8-yl)-N'-propan-2-ylpropane-1,3-diamine,hydrochloride |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 454.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H28ClN3O |
|---|
| Molecular Weight | 337.88700 |
|---|
| Flash Point | 228.7ºC |
|---|
| Exact Mass | 337.19200 |
|---|
| PSA | 37.39000 |
|---|
| LogP | 4.65070 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | NNSPFFLKLKTFKA-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCCNc1cc(OC)cc2cccnc12)C(C)C.Cl |
|---|
