Introduction：Basic information about CAS 6327-69-1|4-Morpholineacetamide, a-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Morpholineacetamide, a-phenyl- |
|---|
| CAS Number | 6327-69-1 | Molecular Weight | 220.26800 |
|---|
| Density | 1.191g/cm3 | Boiling Point | 374.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.6ºC |
|---|
Names
| Name | 2-morpholin-4-yl-2-phenylacetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.191g/cm3 |
|---|
| Boiling Point | 374.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 |
|---|
| Molecular Weight | 220.26800 |
|---|
| Flash Point | 180.6ºC |
|---|
| Exact Mass | 220.12100 |
|---|
| PSA | 55.56000 |
|---|
| LogP | 1.18340 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | GVSAMGMSPJMQHK-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)C(c1ccccc1)N1CCOCC1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Phenyl-1-morpholino-acetamid |
| Morpholino-phenyl-essigsaeure-amid |
| morpholino-phenyl-acetic acid amide |
| 2-morpholin-4-yl-2-phenyl-acetamide |
| 2-Morpholino-2-phenyl-acetamid |
| 2-morpholino-2-phenylacetamide |
