Introduction:Basic information about CAS 186606-17-7|(S)-(-)-1 2 3 4-TETRAHYDRO-2 3-ISO-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-1 2 3 4-TETRAHYDRO-2 3-ISO- |
|---|
| CAS Number | 186606-17-7 | Molecular Weight | 203.19400 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 328ºC at 760mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | 174-178ºC(lit.) |
|---|
| MSDS | / | Flash Point | 152.2ºC |
|---|
Names
| Name | (10aS)-10,10a-dihydro-5H-[1,3]oxazolo[3,4-b]isoquinoline-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 328ºC at 760mmHg |
|---|
| Melting Point | 174-178ºC(lit.) |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.19400 |
|---|
| Flash Point | 152.2ºC |
|---|
| Exact Mass | 203.05800 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.02800 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | MFQCEFDMLXLCGB-VIFPVBQESA-N |
|---|
| SMILES | O=C1OC(=O)N2Cc3ccccc3CC12 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| (S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acidN-carboxy anhydride |
| (10aS)-10,10a-dihydro[1,3]oxazolo[3,4-b]isoquinoline-1,3(5H)-dione |
| (10aS)-5H,10H,10aH-[1,3]oxazolo[3,4-b]isoquinoline-1,3-dione |
| 3H-Oxazolo[3,4-b]isoquinoline-1,3(5H)-dione,10,10a-dihydro-,(10aS) |
| 3H-Oxazolo[3,4-b]isoquinoline-1,3(5H)-dione,10,10a-dihydro-,(S) |