Introduction:Basic information about CAS 18453-32-2|(4-Bromophenyl)(2-pyridinyl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Bromophenyl)(2-pyridinyl)methanone |
|---|
| CAS Number | 18453-32-2 | Molecular Weight | 262.102 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 369.7±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8BrNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.4±20.9 °C |
|---|
Names
| Name | (4-bromophenyl)-pyridin-2-ylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 369.7±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8BrNO |
|---|
| Molecular Weight | 262.102 |
|---|
| Flash Point | 177.4±20.9 °C |
|---|
| Exact Mass | 260.978912 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 2.82 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | CQIMFAYIBRLNCH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccc(Br)cc1)c1ccccn1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Methanone, (4-bromophenyl)-2-pyridinyl- |
| (4-bromophenyl)-2-pyridyl ketone |
| p-Bromphenyl-2-pyridyl-keton |
| EINECS 242-338-3 |
| 4-[pyridin-2-ylcarbonyl]bromobenzene |
| p-BrC6H4[C(O)(2-py)] |
| 4-[2-pyridylcarbonyl]bromobenzene |
| (4-Bromophenyl)(pyridin-2-yl)methanone |
| (4-Bromophenyl)(2-pyridinyl)methanone |
| 2-(4-Bromobenzoyl)pyridine |