Introduction：Basic information about CAS 79449-99-3|icospiramide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | icospiramide |
|---|
| CAS Number | 79449-99-3 | Molecular Weight | 507.57500 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 752.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31F2N5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 408.7ºC |
|---|
Names
| Name | 2-[8-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 752.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31F2N5O2 |
|---|
| Molecular Weight | 507.57500 |
|---|
| Flash Point | 408.7ºC |
|---|
| Exact Mass | 507.24500 |
|---|
| PSA | 94.66000 |
|---|
| LogP | 4.38548 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | HVWIHGNIDIIREZ-UHFFFAOYSA-N |
|---|
| SMILES | N#CC1(c2ccc(F)cc2)CCC(N2CCC3(CC2)C(=O)N(CC(N)=O)CN3c2ccc(F)cc2)CC1 |
|---|
Synonyms
| Icospiramidum |
| Icospiramidum [Latin] |
| Icospiramide |
| Icospiramid |
| Icospiramida |
| Icospiramida [Spanish] |
| 2-{8-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-3-yl}acetamide |
