Introduction：Basic information about CAS 78466-98-5|Razobazam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Razobazam |
|---|
| CAS Number | 78466-98-5 | Molecular Weight | 270.28700 |
|---|
| Density | 1.343g/cm3 | Boiling Point | 706.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 380.9ºC |
|---|
Names
| Name | 3,8-dimethyl-4-phenyl-2H-pyrazolo[3,4-b][1,4]diazepine-5,7-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.343g/cm3 |
|---|
| Boiling Point | 706.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14N4O2 |
|---|
| Molecular Weight | 270.28700 |
|---|
| Flash Point | 380.9ºC |
|---|
| Exact Mass | 270.11200 |
|---|
| PSA | 69.30000 |
|---|
| LogP | 1.87930 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | RHZDHINXKVZTEF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1[nH]nc2c1N(c1ccccc1)C(=O)CC(=O)N2C |
|---|
Synonyms
| Razobazamum [Latin] |
| Razobazamum |
| Razobazam |
| Razobazam [INN] |
| Hoe 175 |
| Pyrazolo(3,4-b)(1,4)diazepine-5,7(1H,6H)-dione,4,8-dihydro-3,8-dimethyl-4-phenyl |
