Introduction：Basic information about CAS 98116-53-1|Sulukast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulukast |
|---|
| CAS Number | 98116-53-1 | Molecular Weight | 472.64300 |
|---|
| Density | 1.169g/cm3 | Boiling Point | 703.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H36N4O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 379.5ºC |
|---|
Names
| Name | 3-[(1S,2R,3E,5Z)-1-hydroxy-1-[3-(2H-tetrazol-5-yl)phenyl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.169g/cm3 |
|---|
| Boiling Point | 703.9ºC at 760 mmHg |
|---|
| Molecular Formula | C25H36N4O3S |
|---|
| Molecular Weight | 472.64300 |
|---|
| Flash Point | 379.5ºC |
|---|
| Exact Mass | 472.25100 |
|---|
| PSA | 137.29000 |
|---|
| LogP | 5.72970 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | YPHOSUPSOWQQCB-AFOLHBCXSA-N |
|---|
| SMILES | CCCCCCCCCC=CC=CC(SCCC(=O)O)C(O)c1cccc(-c2nn[nH]n2)c1 |
|---|
Synonyms
| Sulukastum |
| Sulukast (USAN/INN) |
| UNII-M652A5186T |
| Sulukastum [INN-Latin] |
| Sulukast |
