Introduction:Basic information about CAS 652-40-4|3,6-Difluorophthalic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-Difluorophthalic anhydride |
|---|
| CAS Number | 652-40-4 | Molecular Weight | 184.096 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 315.7±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H2F2O3 | Melting Point | 218-221 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 140.1±20.0 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3,6-Difluorophthalic Anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 315.7±32.0 °C at 760 mmHg |
|---|
| Melting Point | 218-221 °C(lit.) |
|---|
| Molecular Formula | C8H2F2O3 |
|---|
| Molecular Weight | 184.096 |
|---|
| Flash Point | 140.1±20.0 °C |
|---|
| Exact Mass | 183.997192 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.77 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | AVLRPSLTCCWJKC-UHFFFAOYSA-N |
|---|
| SMILES | O=C1OC(=O)c2c(F)ccc(F)c21 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 3,6-Difluoro-1,2-benzenedicarboxylic acid anhydride |
| 4,7-Difluoro-2-benzofuran-1,3-dione |
| 4,7-Difluoro-isobenzofuran-1,3-dione |
| MFCD00134537 |
| 3,6-Difluorophthalic anhydride |
| 4,7-Difluoro-1,3-isobenzofurandione |
| T56 BVOVJ FF IF |
| 1,3-Isobenzofurandione, 4,7-difluoro- |