Introduction：Basic information about CAS 71832-33-2|ethyl(5-isocyanato-2-methylphenyl)carbamoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl(5-isocyanato-2-methylphenyl)carbamoyl chloride |
|---|
| CAS Number | 71832-33-2 | Molecular Weight | 238.67000 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 392.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.2ºC |
|---|
Names
| Name | N-ethyl-N-(5-isocyanato-2-methylphenyl)carbamoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 392.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11ClN2O2 |
|---|
| Molecular Weight | 238.67000 |
|---|
| Flash Point | 191.2ºC |
|---|
| Exact Mass | 238.05100 |
|---|
| PSA | 49.74000 |
|---|
| LogP | 3.14740 |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | JZKGLBABVFZFIL-UHFFFAOYSA-N |
|---|
| SMILES | CCN(C(=O)Cl)c1cc(N=C=O)ccc1C |
|---|
Synonyms
| Carbamic chloride,ethyl(5-isocyanato-2-methylphenyl) |
| Carbamic chloride,N-ethyl-N-(5-isocyanato-2-methylphenyl) |
| Ethyl(5-isocyanato-2-methylphenyl)carbamoyl chloride |
| EINECS 276-048-3 |
| Ethyl(2-methyl-5-isocyanatophenyl)carbamyl chloride |
