Introduction：Basic information about CAS 34761-82-5|3,5-dimethyl-4-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-dimethyl-4-nitroaniline |
|---|
| CAS Number | 34761-82-5 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 331.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.2±26.5 °C |
|---|
Names
| Name | 3,5-dimethyl-4-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 331.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 154.2±26.5 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.31 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | RKYZUYQFTGLAOX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N)cc(C)c1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Dimethyl-4-nitro-anilin |
| 3,5-dimethyl-4-nitro-phenylamine |
| 3,5-dimethyl-4-nitroaniline |
| Benzenamine,3,5-dimethyl-4-nitro |
| 3,5-DIMETHYL-4-NITROBENZENAMINE |
| 2-Nitro-5-amino-m-xylol |
| Benzenamine, 3,5-dimethyl-4-nitro- |
| 1-Amino-4-nitro-3,5-dimethyl-benzol |
| 3,5-dimethyl-4-nitro-benzenamine |
| 3,5-dimethyl-4-nitro-aniline |
