Introduction：Basic information about CAS 49744-26-5|2-(2-methoxyethoxy)ethyl 4-[(5-cyano-1-ethyl-1,6-dihydro-2-hydroxy-4-methyl-6-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-methoxyethoxy)ethyl 4-[(5-cyano-1-ethyl-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate |
|---|
| CAS Number | 49744-26-5 | Molecular Weight | 428.43800 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 541.3ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N4O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.2ºC |
|---|
Names
| Name | 2-(2-methoxyethoxy)ethyl 4-[(2Z)-2-(5-cyano-1-ethyl-4-methyl-2,6-dioxopyridin-3-ylidene)hydrazinyl]benzoate |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 541.3ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N4O6 |
|---|
| Molecular Weight | 428.43800 |
|---|
| Flash Point | 281.2ºC |
|---|
| Exact Mass | 428.17000 |
|---|
| PSA | 130.32000 |
|---|
| LogP | 1.51398 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | AKKLPLPBIJUVIJ-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(O)c(C#N)c(C)c(N=Nc2ccc(C(=O)OCCOCCOC)cc2)c1=O |
|---|
