Introduction：Basic information about CAS 49828-75-3|phenproxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenproxide |
|---|
| CAS Number | 49828-75-3 | Molecular Weight | 339.79400 |
|---|
| Density | 1.42g/cm3 | Boiling Point | 500.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H14ClNO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.6ºC |
|---|
Names
| Name | phenproxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Boiling Point | 500.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H14ClNO4S |
|---|
| Molecular Weight | 339.79400 |
|---|
| Flash Point | 256.6ºC |
|---|
| Exact Mass | 339.03300 |
|---|
| PSA | 91.33000 |
|---|
| LogP | 5.94700 |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | SVZDUAFLNFAGIA-UHFFFAOYSA-N |
|---|
| SMILES | CCCS(=O)c1cc(Oc2ccc([N+](=O)[O-])cc2)ccc1Cl |
|---|
Synonyms
| NK 493 |
| 1-chloro-4-(4-nitrophenoxy)-2-(propanesulfinyl)benzene |
| 1-chloro-4-(4-nitrophenoxy)-2-propylsulfinylbenzene |
| Phenproxide |
| 2-chloro-5-(4-nitrophenoxy)phenyl propyl sulfoxide |
| 1-chloro-4-(4-nitrophenoxy)-2-(propylsulfinyl)benzene |
| UNII-704XX5D850 |
