CAS 98-74-8|nosyl chloride
| Common Name | nosyl chloride | ||
|---|---|---|---|
| CAS Number | 98-74-8 | Molecular Weight | 221.618 |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 349.7±25.0 °C at 760 mmHg |
| Molecular Formula | C6H4ClNO4S | Melting Point | 75 °C |
| MSDS | ChineseUSA | Flash Point | 165.3±23.2 °C |
| Symbol | GHS05 | Signal Word | Danger |
Names
| Name | 4-Nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.7±25.0 °C at 760 mmHg |
| Melting Point | 75 °C |
| Molecular Formula | C6H4ClNO4S |
| Molecular Weight | 221.618 |
| Flash Point | 165.3±23.2 °C |
| Exact Mass | 220.954956 |
| PSA | 88.34000 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Cl)cc1 |
| Water Solubility | Insoluble |
Safety Information
| Symbol | GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34;R52/53 |
| Safety Phrases | S26-S36/37/39-S45-S61 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29049085 |
Customs
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
Articles5
More Articles| Design, synthesis, and bioevaluation of paeonol derivatives as potential anti-HBV agents. Eur. J. Med. Chem. 90 , 428-35, (2015) Hepatitis B virus (HBV) is a causative reagent that frequently causes progressive liver diseases, leading to the development of acute, chronic hepatitis, cirrhosis, and eventually hepatocellular carci... | |
| Procedure for increasing the detection responses of estrogens in LC-MS based on introduction of a nitrobenzene moiety followed by electron capture atmospheric pressure chemical ionization. Anal. Bioanal. Chem 386(3) , 658-65, (2006) A practical procedure for determining estrogens in biological fluids has been studied using liquid chromatography-electron capture atmospheric pressure chemical ionization-mass spectrometry combined w... | |
| Synthesis and Crystal Structure of a Five-Coordinate Complex of Copper(II) with 4-Nitrobenzenesulfonate and 2, 2'-Bipyridine. Acta Chim. Slov. 59(2) , 289-93, (2012) [Cu(bipy)2Cl](nbs) (1) (bipy = 2,2'-bipyridine, nbs = 4-nitrobenzenesulfonate) was obtained from the reaction of 4-nitrobenzenesulfonyl chloride and 2-amine-4-methylopyridine with CuCl2 in the presenc... |
Synonyms
| Benzenesulfonyl chloride, p-nitro- |
| 4-Nitrobenzenesulfonic acid chloride |
| Benzenesulfonyl chloride, 4-nitro- |
| 4-Nitrobenzenesulfon |
| p-Nitrophenylsulfonyl chloride |
| 4-Nitrobenzenesulphonylchloride |
| para-nitrobenzenesulfonyl chloride |
| MFCD00007445 |
| 4-nitrobenzene-1-sulfonyl chloride |
| 4-Nitrobenzenesulfonyl chloride |
| 4-nitro-benzenesulfonyl chloride |
| EINECS 202-697-9 |
| 4-NITROPHENYLSULFONYL CHLORIDE |
| 4-nitro-benzenesulfonylchlorid |
| Nosylchloride |
| 4-nitrophenylsulphonyl chloride |
| P-NITROBENZENESULFONYL CHLORIDE |
| 4-Nitrophenylsulfonylchloride |
| 5-Nitrobenzenesulfonyl chloride |
| nosyl chloride |
| 4-NITROBENZENESULFONYLCHLORIDE |
