Introduction:Basic information about CAS 5823-12-1|triethyl 2,2-dichloro-2-phosphonoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | triethyl 2,2-dichloro-2-phosphonoacetate |
|---|
| CAS Number | 5823-12-1 | Molecular Weight | 293.08100 |
|---|
| Density | 1.289 g/mL at 25ºC(lit.) | Boiling Point | 84-86ºC0.01 mm Hg(lit.) |
|---|
| Molecular Formula | C8H15Cl2O5P | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | ethyl 2,2-dichloro-2-diethoxyphosphorylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289 g/mL at 25ºC(lit.) |
|---|
| Boiling Point | 84-86ºC0.01 mm Hg(lit.) |
|---|
| Molecular Formula | C8H15Cl2O5P |
|---|
| Molecular Weight | 293.08100 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 292.00300 |
|---|
| PSA | 71.64000 |
|---|
| LogP | 2.94700 |
|---|
| Index of Refraction | n20/D 1.456(lit.) |
|---|
| InChIKey | PNIZABWIGNVQCB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Cl)(Cl)P(=O)(OCC)OCC |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| ethyl 2,2-dichloro-2-diethylphosphonoacetate |
| 2,2-Dichlor-2-diaethylphosphonoessigsaeureaethylester |
| Triethyl dichloromethylphosphonoacetate |
| MFCD00192517 |
| Ethoxycarbonyldichlormethyl-phosphonsaeure-diethylester |
| Triethyl 2,2-dichloro-2-phosphonoacetate |
| triethyl dichlorophosphonoacetate |
| 2-Diaethoxyphosphinyl-dichloressigsaeureaethylester |
| triethyl 2,2-dichlorophosphonoacetate |