Introduction：Basic information about CAS 330-11-0|4-(trifluoromethoxy)benzoyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethoxy)benzoyl fluoride |
|---|
| CAS Number | 330-11-0 | Molecular Weight | 208.11000 |
|---|
| Density | 1.384g/cm3 | Boiling Point | 179.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H4F4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 61.2ºC |
|---|
Names
| Name | 4-(trifluoromethoxy)benzoyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.384g/cm3 |
|---|
| Boiling Point | 179.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H4F4O2 |
|---|
| Molecular Weight | 208.11000 |
|---|
| Flash Point | 61.2ºC |
|---|
| Exact Mass | 208.01500 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 2.69490 |
|---|
| Index of Refraction | 1.431 |
|---|
| InChIKey | UKJWAZZCGZQPTA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(F)c1ccc(OC(F)(F)F)cc1 |
|---|
Safety Information
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
Synonyms
| p-Trifluoromethoxybenzoyl fluoride |
| EINECS 206-351-8 |
| 4-trifluoromethoxy-benzoyl fluoride |
| 4-Trifluormethoxy-benzoylfluorid |
| 2,2,3,3-TETRAFLUORO-1,4-BUTANEDIOL |
| Benzoyl fluoride,4-(trifluoromethoxy) |
