Introduction：Basic information about CAS 375-14-4|2-Pentanol,3,3,4,4,5,5,5-heptafluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pentanol,3,3,4,4,5,5,5-heptafluoro- |
|---|
| CAS Number | 375-14-4 | Molecular Weight | 214.08100 |
|---|
| Density | 1.483 | Boiling Point | 101ºC |
|---|
| Molecular Formula | C5H5F7O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 101-102ºC |
|---|
Names
| Name | 3,3,4,4,5,5,5-heptafluoropentan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.483 |
|---|
| Boiling Point | 101ºC |
|---|
| Molecular Formula | C5H5F7O |
|---|
| Molecular Weight | 214.08100 |
|---|
| Flash Point | 101-102ºC |
|---|
| Exact Mass | 214.02300 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 2.20010 |
|---|
| Index of Refraction | 1.314 |
|---|
| InChIKey | RBPHBIMHZSTIDT-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F: Flammable; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S23-S26-S36 |
|---|
Synonyms
| MFCD00039619 |
| EINECS 206-784-2 |
| 3,3,4,4,5,5,5-heptafluoro-pentan-2-ol |
| 3,3,4,4,5,5,5-Heptafluor-pentan-2-ol |
| 3,3,4,4,5,5,5-Heptafluoro-2-pentanol |
| 1-methyl-2,2,3,3,4,4,4-heptafluorobutanol |
| 3,3,4,4,5,5,5-heptafluoropentanol-2 |
