Introduction：Basic information about CAS 477-93-0|Dimethoxanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethoxanate |
|---|
| CAS Number | 477-93-0 | Molecular Weight | 358.45500 |
|---|
| Density | 1.234g/cm3 | Boiling Point | 494ºC at 760mmHg |
|---|
| Molecular Formula | C19H22N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.6ºC |
|---|
Names
| Name | 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234g/cm3 |
|---|
| Boiling Point | 494ºC at 760mmHg |
|---|
| Molecular Formula | C19H22N2O3S |
|---|
| Molecular Weight | 358.45500 |
|---|
| Flash Point | 252.6ºC |
|---|
| Exact Mass | 358.13500 |
|---|
| PSA | 67.31000 |
|---|
| LogP | 4.06910 |
|---|
| Vapour Pressure | 6.7E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | OOVJCSPCMCAXEX-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCOCCOC(=O)N1c2ccccc2Sc2ccccc21 |
|---|
Synonyms
| Dimethoxanate [INN:BAN] |
| Dimethoxanate |
| Dimethoxanate (INN) |
| Tussidin |
| Dimethoxanatum [INN-Latin] |
| Dimethoxanatum |
| Phenothiazin-N-carbonsaeure-<2-(2-dimethylamino-aethoxy)-aethylester |
| UNII-1E3KG5FWDB |
| phenothiazine-10-carboxylic acid 2-(2-dimethylamino-ethoxy)-ethyl ester |
| Phenothiazin-carbonsaeure-(10)-<2-(2-dimethylamino-aethoxy)-aethylester |
| Dimetoxanato |
