Introduction：Basic information about CAS 6359-29-1|Mordant red 15, Technical grade, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mordant red 15, Technical grade |
|---|
| CAS Number | 6359-29-1 | Molecular Weight | 431.43700 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 683.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H21NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 367.3ºC |
|---|
Names
| Name | 6'-(diethylamino)-3'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 683.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H21NO6 |
|---|
| Molecular Weight | 431.43700 |
|---|
| Flash Point | 367.3ºC |
|---|
| Exact Mass | 431.13700 |
|---|
| PSA | 96.30000 |
|---|
| LogP | 4.50460 |
|---|
| Index of Refraction | 1.722 |
|---|
| InChIKey | LJYFQGHCZXNILU-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(O)c(C(=O)O)cc1C21OC(=O)c2ccccc21 |
|---|
Synonyms
| EINECS 228-797-2 |
| 6'-(diethylamino)-3'-hydroxy-3-oxo-3h-spiro[2-benzofuran-1,9'-xanthene]-2'-carboxylic acid |
| 6'-(Diethylamino)-3'-hydroxy-3-oxospiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2'-carboxylic acid |
