Introduction:Basic information about CAS 3457-46-3|4,4'-Dichloro benzil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dichloro benzil |
|---|
| CAS Number | 3457-46-3 | Molecular Weight | 279.118 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 427.3±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8Cl2O2 | Melting Point | 194-197ºC |
|---|
| MSDS | / | Flash Point | 180.4±25.1 °C |
|---|
Names
| Name | 4,4'-Dichlorobenzil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 427.3±30.0 °C at 760 mmHg |
|---|
| Melting Point | 194-197ºC |
|---|
| Molecular Formula | C14H8Cl2O2 |
|---|
| Molecular Weight | 279.118 |
|---|
| Flash Point | 180.4±25.1 °C |
|---|
| Exact Mass | 277.990143 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.91 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00018685 |
| 1,2-bis(p-chlorophenyl)ethanedione |
| 4,4'-Dichlorobibenzoyl |
| 4,4'-dichlorobenzil |
| Bis(p-chlorophenyl)ethanedione |
| 4,4'-Dichlorodibenzoyl |
| 1,2-bis(4-chlorophenyl)ethanedione |
| Bis(4-chlorophenyl) diketone |
| 1,2-Ethanedione, 1,2-bis(4-chlorophenyl)- |
| p,p'-Dichlorobenzil |
| Ethanedione, bis(4-chlorophenyl)- |
| Benzil, 4,4'-dichloro- |
| 1,2-di(4-chlorophenyl)-1,2-ethanedione |
| bis(4-chlorophenyl)ethanedione |
| 1,2-Bis(4-chlorophenyl)ethane-1,2-dione |
| 1,2-Bis(4-chlorophenyl)-1,2-ethanedione |
| 1,2-BIS-(4-CHLORO-PHENYL)-ETHANE-1,2-DIONE |
| EINECS 222-387-7 |
| Di(4-chlorophenyl) diketone |
| 4,4'-Dichloro benzil |
| 1,2-bis(4-chlorophenyl)ethanediol |