Introduction：Basic information about CAS 58821-98-0|12-deoxyphorbol 13-phenylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 12-deoxyphorbol 13-phenylacetate |
|---|
| CAS Number | 58821-98-0 | Molecular Weight | 466.56600 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 633.4ºC at 760mmHg |
|---|
| Molecular Formula | C28H34O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.1ºC |
|---|
Names
| Name | 12-deoxyphorbol 13-phenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 633.4ºC at 760mmHg |
|---|
| Molecular Formula | C28H34O6 |
|---|
| Molecular Weight | 466.56600 |
|---|
| Flash Point | 209.1ºC |
|---|
| Exact Mass | 466.23600 |
|---|
| PSA | 104.06000 |
|---|
| LogP | 2.75290 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | JAMGGIDPOXFRAM-RFYIAXDNSA-N |
|---|
| SMILES | CC1=CC2C(O)(CC(CO)=CC3C4C(C)(C)C4(OC(=O)Cc4ccccc4)CC(C)C32O)C1=O |
|---|
Synonyms
| 9a-phenylacetate |
| 12-deoxyphorbol-13-phenylacetate |
| 12-Deoxyphorbolphenylacetate |
