Introduction:Basic information about CAS 784127-15-7|ethyl 1-(aminomethyl)-6,8-dimethoxyisoquinoline-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 1-(aminomethyl)-6,8-dimethoxyisoquinoline-4-carboxylate |
|---|
| CAS Number | 784127-15-7 | Molecular Weight | 290.31400 |
|---|
| Density | 1.214g/cm3 | Boiling Point | 465.847ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.536ºC |
|---|
Names
| Name | ethyl 1-(aminomethyl)-6,8-dimethoxyisoquinoline-4-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.214g/cm3 |
|---|
| Boiling Point | 465.847ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O4 |
|---|
| Molecular Weight | 290.31400 |
|---|
| Flash Point | 235.536ºC |
|---|
| Exact Mass | 290.12700 |
|---|
| PSA | 83.67000 |
|---|
| LogP | 2.58770 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | YWERKLDMXHCBDE-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cnc(CN)c2c(OC)cc(OC)cc12 |
|---|