Introduction：Basic information about CAS 632-83-7|1-Bromo-9,10-anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-9,10-anthraquinone |
|---|
| CAS Number | 632-83-7 | Molecular Weight | 287.108 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 444.9±34.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H7BrO2 | Melting Point | 191ºC |
|---|
| MSDS | / | Flash Point | 161.0±12.2 °C |
|---|
Names
| Name | 1-Bromoanthraquinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 444.9±34.0 °C at 760 mmHg |
|---|
| Melting Point | 191ºC |
|---|
| Molecular Formula | C14H7BrO2 |
|---|
| Molecular Weight | 287.108 |
|---|
| Flash Point | 161.0±12.2 °C |
|---|
| Exact Mass | 285.962921 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.16 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | CXTPIHZYOGDSLV-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c(Br)cccc21 |
|---|
Synonyms
| 9,10-Anthracenedione, 1-bromo- |
| L C666 BV IVJ DE |
| 1-Bromo-9,10-anthracenedione |
| 1-bromoanthracene-9,10-dione |
| 1-Bromo-9,10-anthraquinone |
