Introduction:Basic information about CAS 6331-68-6|Benzenesulfonamide,3-amino-N,N,4-trimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,3-amino-N,N,4-trimethyl- |
|---|
| CAS Number | 6331-68-6 | Molecular Weight | 214.28500 |
|---|
| Density | 1.234g/cm3 | Boiling Point | 371.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.2ºC |
|---|
Names
| Name | 3-amino-N,N,4-trimethylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234g/cm3 |
|---|
| Boiling Point | 371.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H14N2O2S |
|---|
| Molecular Weight | 214.28500 |
|---|
| Flash Point | 178.2ºC |
|---|
| Exact Mass | 214.07800 |
|---|
| PSA | 71.78000 |
|---|
| LogP | 2.48950 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | PNFOLOVDVLPCBX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1N |
|---|
Synonyms
| 3-Amino-4,N,N-trimethyl-benzenesulfonamide |
| 2-Aminotoluol-4-sulfondimethylamid |
| 2-Methyl-5-(dimethylsulfamoyl)aniline |
| 2-Amino-toluol-4-sulfonsaeure-dimethylamid |
| 2-amino-N,N-dimethyltoluene-4-sulfonamide |