Introduction：Basic information about CAS 58710-66-0|2-(Methoxycarbonyl)aminophenylaminothioxomethyl-carbamic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Methoxycarbonyl)aminophenylaminothioxomethyl-carbamic acid methyl ester |
|---|
| CAS Number | 58710-66-0 | Molecular Weight | 283.30400 |
|---|
| Density | 1.426 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H13N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [[[2-[(methoxycarbonyl)amino]phenyl]amino]thioxomethyl]-carbamic acid methyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.426 g/cm3 |
|---|
| Molecular Formula | C12H13N2O4S |
|---|
| Molecular Weight | 283.30400 |
|---|
| Exact Mass | 283.06300 |
|---|
| PSA | 120.78000 |
|---|
| LogP | 2.45460 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | POWCBWCFIQLMQB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)NC(=S)Nc1ccccc1NC(=O)OC |
|---|
Synonyms
| Carbamic acid,[[[2-[(methoxycarbonyl)amino]phenyl]amino]thioxomethyl]-,methyl ester |
| Methyl-4-(o-methoxycarbonylaminophenyl)-3-thioallophanat |
| 2-(Methoxycarbonyl)aminophenylaminothioxomethyl-carbamic acid methyl ester |
