CAS 33973-59-0|Triacetonamine hydrochloride
Introduction:Basic information about CAS 33973-59-0|Triacetonamine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triacetonamine hydrochloride | ||
|---|---|---|---|
| CAS Number | 33973-59-0 | Molecular Weight | 191.698 |
| Density | 0.882g/cm3 | Boiling Point | 205.6ºC at 760mmHg |
| Molecular Formula | C9H18ClNO | Melting Point | 198 °C (dec.)(lit.) |
| MSDS | / | Flash Point | 73.2ºC |
Names
| Name | 2,2,6,6-tetramethylpiperidin-4-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 0.882g/cm3 |
|---|---|
| Boiling Point | 205.6ºC at 760mmHg |
| Melting Point | 198 °C (dec.)(lit.) |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.698 |
| Flash Point | 73.2ºC |
| Exact Mass | 191.107697 |
| PSA | 29.10000 |
| LogP | 2.62690 |
| InChIKey | ZXNWYMNKYXUZGM-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1.Cl |
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S24/25 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
Customs
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Synonyms
| 2,2,6,6-Tetramethyl-4-piperidone, hydrochloride |
| 4-Piperidinone, 2,2,6,6-tetramethyl-, hydrochloride |
| 4-Piperidinone, 2,2,6,6-tetramethyl-, hydrochloride (1:1) |
| 2,2,6,6-Tetramethylpiperidin-4-one hydrochloride (1:1) |
| 2,2,6,6-tetramethylpiperidin-4-one,chloride |
| 2,2,6,6-TETRACHLOROCYCLOHEXANOL |
| 2,2,6,6-tetramethyl-4-piperadone hydrochloride |
| MFCD00012768 |
| 2,2,6,6-Tetramethyl-4-azacyclohexanone Hydrochloride |
| chlorhydrate de triacetonamine |
| 2,2,6,6-TetraMethyl-4-piperidone Hydrochloride |
| 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride (1:1) |
| 2,2,6,6-tetramethylpiperidone hydrochloride |
| Triacetonamine Hydrochloride |
| 2,2,6,6-tetramethylpiperidine-4-one monohydrochloride |
| 2,2,6,6-tetramethylpiperidin-4-one hydrochloride |
| EINECS 251-769-6 |
