Introduction:Basic information about CAS 74965-38-1|2-Boc-Aminobenzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Boc-Aminobenzaldehyde |
|---|
| CAS Number | 74965-38-1 | Molecular Weight | 221.25200 |
|---|
| Density | 1.163g/cm3 | Boiling Point | 291.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | 57-61 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 130.2ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl N-(2-formylphenyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.163g/cm3 |
|---|
| Boiling Point | 291.7ºC at 760 mmHg |
|---|
| Melting Point | 57-61 °C |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Flash Point | 130.2ºC |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 2.91910 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | DHALMIBUKCNMLD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1C=O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317 |
|---|
| Precautionary Statements | P280 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22-43 |
|---|
| Safety Phrases | 36/37-61 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-tert-butoxycarbonyl-2-aminobenzaldehyde |
| tert-ButylN-(2-formylphenyl)carbamate |
| 1,1-Dimethylethyl2-formylphenylcarbamate |
| N-tert-butoxycarbonylamino benzaldehyde |
| 2-Boc-aminobenzaldehyde |
| 2-amino-N-tert-butoxycarbonylbenzaldehyde |
| 2-(tert-butyloxycarbonyl)aminobenzaldehyde |
| Carbamic acid,(2-formylphenyl)-,1,1-dimethylethyl ester |
| Carbamicacid,(2-formylphenyl)-,1,1-dimethylethyl ester (9CI) |
| tert-Butyl (2-formylphenyl)carbamate |
| (2-formyl-phenyl)-carbamic acid tert-butyl ester |
| (2-Formylphenyl)carbamic acid 1,1-dimethylethyl ester |