Introduction:Basic information about CAS 13277-74-2|Pentanedioic acid,2,4-diacetyl-3-phenyl-, 1,5-diethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pentanedioic acid,2,4-diacetyl-3-phenyl-, 1,5-diethyl ester |
|---|
| CAS Number | 13277-74-2 | Molecular Weight | 348.39000 |
|---|
| Density | 1.136g/cm3 | Boiling Point | 467.3ºC at 760mmHg |
|---|
| Molecular Formula | C19H24O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.1ºC |
|---|
Names
| Name | diethyl 2,4-diacetyl-3-phenylpentanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.136g/cm3 |
|---|
| Boiling Point | 467.3ºC at 760mmHg |
|---|
| Molecular Formula | C19H24O6 |
|---|
| Molecular Weight | 348.39000 |
|---|
| Flash Point | 203.1ºC |
|---|
| Exact Mass | 348.15700 |
|---|
| PSA | 86.74000 |
|---|
| LogP | 2.30680 |
|---|
| Vapour Pressure | 6.59E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.5 |
|---|
| InChIKey | VJDMHFPDRYFKOU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(C)=O)C(c1ccccc1)C(C(C)=O)C(=O)OCC |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,4-Diacetyl-3-phenyl-glutarsaeure-diaethylester |
| Benzyliden-diacetessigester |
| 2,4-Diacetyl-3-phenyl-glutarsaeurediethylester |
| 2,4-diacetyl-3-phenyl-glutaric acid diethyl ester |
| Benzyliden-bis-(acetessigsaeure-ethylester) |