Introduction:Basic information about CAS 77215-55-5|(S)-tert-butyl3-amino-2-(((benzyloxy)carbonyl)amino)propanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-tert-butyl3-amino-2-(((benzyloxy)carbonyl)amino)propanoate |
|---|
| CAS Number | 77215-55-5 | Molecular Weight | 294.34600 |
|---|
| Density | 1.142g/cm3 | Boiling Point | 444.312ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.512ºC |
|---|
Names
| Name | tert-butyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.142g/cm3 |
|---|
| Boiling Point | 444.312ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22N2O4 |
|---|
| Molecular Weight | 294.34600 |
|---|
| Flash Point | 222.512ºC |
|---|
| Exact Mass | 294.15800 |
|---|
| PSA | 90.65000 |
|---|
| LogP | 2.67300 |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | GUTOOFAUODQZRP-LBPRGKRZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)C(CN)NC(=O)OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| tert-butyl (2S)-3-amino-2-{[(benzyloxy)carbonyl]amino}propanoate |
| tert-butyl-(2S)-2-benzyloxycarbonylamino-3-aminopropionate |
| tert-butyl (S)-3-amino-2-benzyloxycarbonylaminopropionate |
| (2S)-3-amino-2-benzyloxycarbonylamino-propionic acid tert-butyl ester |
| (s)-3-amino-2-cbz-amino-propionic acid tert-butyl ester |
| 2S-(benzyloxycarbonylamino)-3-aminopropionic acid tert-butylester |
| TERT-BUTYL (2S)-3-AMINO-2-BENZYLOXYCARBONYLAMINOPROPIONATE |
| A9778 |
| 3-amino-2-S-benzyloxycarbonyl-aminopropionic acid tert-butyl ester |
| (S)-tert-butyl 3-amino-2-(benzyloxycarbonyl)propanoate |
| tert-butyl N2-benzyloxycarbonyl-2(S)-2,3-diaminopropionate |