Introduction：Basic information about CAS 1842-70-2|methyl 10-oxooctadecanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 10-oxooctadecanoate |
|---|
| CAS Number | 1842-70-2 | Molecular Weight | 312.48700 |
|---|
| Density | 0.911g/cm3 | Boiling Point | 407.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H36O3 | Melting Point | 47-51ºC(lit.) |
|---|
| MSDS | / | Flash Point | 173.2ºC |
|---|
Names
| Name | methyl 10-oxooctadecanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.911g/cm3 |
|---|
| Boiling Point | 407.8ºC at 760 mmHg |
|---|
| Melting Point | 47-51ºC(lit.) |
|---|
| Molecular Formula | C19H36O3 |
|---|
| Molecular Weight | 312.48700 |
|---|
| Flash Point | 173.2ºC |
|---|
| Exact Mass | 312.26600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 5.59990 |
|---|
| Vapour Pressure | 7.34E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.448 |
|---|
| InChIKey | NNUFZSSGONRIJT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCC(=O)CCCCCCCC(=O)OC |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 9-Oxostearic acid methyl ester |
| 9-keto-octadecanoic acid methyl ester |
| 9-Oxo-methylstearinate |
| 9-Ketostearic acid methyl ester |
| methyl 9-oxo-octadecanoate |
| octadecanoic acid 9-oxo methyl ester |
| MFCD00192310 |
