Introduction:Basic information about CAS 18092-54-1|4-methoxy-2-nitrobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methoxy-2-nitrobenzenesulfonyl chloride |
|---|
| CAS Number | 18092-54-1 | Molecular Weight | 251.64400 |
|---|
| Density | 1.553g/cm3 | Boiling Point | 416.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H6ClNO5S | Melting Point | 78ºC |
|---|
| MSDS | USA | Flash Point | 205.5ºC |
|---|
Names
| Name | 4-methoxy-2-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.553g/cm3 |
|---|
| Boiling Point | 416.2ºC at 760mmHg |
|---|
| Melting Point | 78ºC |
|---|
| Molecular Formula | C7H6ClNO5S |
|---|
| Molecular Weight | 251.64400 |
|---|
| Flash Point | 205.5ºC |
|---|
| Exact Mass | 250.96600 |
|---|
| PSA | 97.57000 |
|---|
| LogP | 3.13490 |
|---|
| Vapour Pressure | 3.91mmHg at 25°C |
|---|
| Index of Refraction | 1.479 |
|---|
| InChIKey | OGHAPVZVXLHURO-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)Cl)c([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Methoxy-2-nitrobenzenesulphonyl chloride |
| 4-Methoxy-2-nitrobenzenesulfonyl chloride |
| EINECS 241-996-9 |
| 4-Methoxy-2-nitrophenylsulfonylchlorid |
| 4-methoxy-2-nitrobenzene-1-sulfonyl chloride |
| 2-Nitro-4-methoxyphenylsulfonyl chloride |
| 4-methoxy-2-nitrobenzenesulfonylchloride |
| 2-Nitro-4-methoxy-benzolsulfonsaeure-chlorid |
| 4-Methoxy-2-nitrobenzolsulfonylchlorid |