Introduction:Basic information about CAS 181035-72-3|Ethyl 4-acetoxy-8-isopropyl-6-methoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-8-isopropyl-6-methoxy-2-naphthoate |
|---|
| CAS Number | 181035-72-3 | Molecular Weight | 330.37500 |
|---|
| Density | 1.141g/cm3 | Boiling Point | 465.421ºC at 760 mmHg |
|---|
| Molecular Formula | C19H22O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.764ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-8-isopropyl-6-methoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.141g/cm3 |
|---|
| Boiling Point | 465.421ºC at 760 mmHg |
|---|
| Molecular Formula | C19H22O5 |
|---|
| Molecular Weight | 330.37500 |
|---|
| Flash Point | 203.764ºC |
|---|
| Exact Mass | 330.14700 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 4.07380 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | BRFHWPQQLGZKEG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2cc(OC)cc(C(C)C)c2c1 |
|---|