Introduction：Basic information about CAS 181258-94-6|Methyl 4-acetoxy-8-phenoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-8-phenoxy-2-naphthoate |
|---|
| CAS Number | 181258-94-6 | Molecular Weight | 336.33800 |
|---|
| Density | 1.247g/cm3 | Boiling Point | 497.536ºC at 760 mmHg |
|---|
| Molecular Formula | C20H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.604ºC |
|---|
Names
| Name | Methyl 4-acetoxy-8-phenoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.247g/cm3 |
|---|
| Boiling Point | 497.536ºC at 760 mmHg |
|---|
| Molecular Formula | C20H16O5 |
|---|
| Molecular Weight | 336.33800 |
|---|
| Flash Point | 219.604ºC |
|---|
| Exact Mass | 336.10000 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 4.34400 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | NKHVXXICKRFZGA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cccc(Oc3ccccc3)c2c1 |
|---|
