Introduction：Basic information about CAS 236751-71-6|7-Chloro-4-hydroxy-5,8-dimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Chloro-4-hydroxy-5,8-dimethoxy-2-naphthoic acid |
|---|
| CAS Number | 236751-71-6 | Molecular Weight | 282.67600 |
|---|
| Density | / | Boiling Point | 506.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 260.2ºC |
|---|
Names
| Name | 7-Chloro-4-hydroxy-5,8-dimethoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Boiling Point | 506.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClO5 |
|---|
| Molecular Weight | 282.67600 |
|---|
| Flash Point | 260.2ºC |
|---|
| Exact Mass | 282.03000 |
|---|
| PSA | 75.99000 |
|---|
| LogP | 2.91420 |
|---|
| Vapour Pressure | 4.34E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | FTRKQTKMXUBRMJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(Cl)cc(OC)c2c(O)cc(C(=O)O)cc12 |
|---|
