Introduction:Basic information about CAS 225114-49-8|Methyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate |
|---|
| CAS Number | 225114-49-8 | Molecular Weight | 381.21800 |
|---|
| Density | 1.398g/cm3 | Boiling Point | 487.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.5ºC |
|---|
Names
| Name | Methyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.398g/cm3 |
|---|
| Boiling Point | 487.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17BrO5 |
|---|
| Molecular Weight | 381.21800 |
|---|
| Flash Point | 248.5ºC |
|---|
| Exact Mass | 380.02600 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 4.10140 |
|---|
| Vapour Pressure | 1.2E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | FWMTVZSFCZIHRC-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2c(OC(C)C)ccc(Br)c2c1 |
|---|