Introduction：Basic information about CAS 477849-65-3|Ethyl 4-(allyloxy)-6,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-(allyloxy)-6,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 477849-65-3 | Molecular Weight | 316.34800 |
|---|
| Density | 1.137g/cm3 | Boiling Point | 466.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.8ºC |
|---|
Names
| Name | Ethyl 4-(allyloxy)-6,8-dimethoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.137g/cm3 |
|---|
| Boiling Point | 466.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O5 |
|---|
| Molecular Weight | 316.34800 |
|---|
| Flash Point | 205.8ºC |
|---|
| Exact Mass | 316.13100 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 3.59850 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | XPYCNHDAQNKEAC-UHFFFAOYSA-N |
|---|
| SMILES | C=CCOc1cc(C(=O)OCC)cc2c(OC)cc(OC)cc12 |
|---|
Synonyms
| Ethyl 4-allyloxyacetoacetate |
| ethyl 4-allyloxy-3-oxobutanoate |
| ethyl 4-allyloxy-6,8-dimethoxynaphthalene-2-carboxylate |
| 4-allyloxyacetoacetate |
| 4-allyloxy-6,8-dimethoxynaphthalene-2-carboxylic acid ethyl ester |
| ethyl 4-allyloxy-3-oxobutyrate |
