Introduction:Basic information about CAS 828940-38-1|Ethyl 5-(benzyloxy)-4-hydroxy-7,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5-(benzyloxy)-4-hydroxy-7,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 828940-38-1 | Molecular Weight | 382.40600 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 582ºC at 760 mmHg |
|---|
| Molecular Formula | C22H22O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.6ºC |
|---|
Names
| Name | Ethyl 5-(benzyloxy)-4-hydroxy-7,8-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 582ºC at 760 mmHg |
|---|
| Molecular Formula | C22H22O6 |
|---|
| Molecular Weight | 382.40600 |
|---|
| Flash Point | 203.6ºC |
|---|
| Exact Mass | 382.14200 |
|---|
| PSA | 74.22000 |
|---|
| LogP | 4.31830 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | FQBYVFPAPIUZOL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2c(OCc3ccccc3)cc(OC)c(OC)c2c1 |
|---|