Introduction：Basic information about CAS 79253-92-2|Taziprinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Taziprinone |
|---|
| CAS Number | 79253-92-2 | Molecular Weight | 385.50000 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 597.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H31N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.3ºC |
|---|
Names
| Name | N-[(4R,4aR,9bS)-8,9b-Dimethyl-3-oxo-1,2,3,4,4a,9b-hexahydrodibenz o[b,d]furan-4-yl]-3-(4-methyl-1-piperazinyl)propanamide |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 597.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H31N3O3 |
|---|
| Molecular Weight | 385.50000 |
|---|
| Flash Point | 315.3ºC |
|---|
| Exact Mass | 385.23700 |
|---|
| PSA | 65.37000 |
|---|
| LogP | 2.21500 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | IQRFTIWMGLZYTL-FKBYEOEOSA-N |
|---|
| SMILES | Cc1ccc2c(c1)C1(C)CCC(=O)C(NC(=O)CCN3CCN(C)CC3)C1O2 |
|---|
