Introduction：Basic information about CAS 349-22-4|4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid |
|---|
| CAS Number | 349-22-4 | Molecular Weight | 210.20200 |
|---|
| Density | 1.243g/cm3 | Boiling Point | 391.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11FO3 | Melting Point | 119 °C |
|---|
| MSDS | / | Flash Point | 190.4ºC |
|---|
Names
| Name | 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Boiling Point | 391.3ºC at 760 mmHg |
|---|
| Melting Point | 119 °C |
|---|
| Molecular Formula | C11H11FO3 |
|---|
| Molecular Weight | 210.20200 |
|---|
| Flash Point | 190.4ºC |
|---|
| Exact Mass | 210.06900 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.18160 |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | RDWYSVCUOZOEBC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)CCC(=O)O)ccc1F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-(4-Fluoro-3-methyl-phenyl)-4-oxo-butyric acid |
| 4-(4-Fluor-3-methyl-phenyl)-4-oxo-buttersaeure |
