Introduction：Basic information about CAS 82064-15-1|4-nitrophenanthrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-nitrophenanthrene |
|---|
| CAS Number | 82064-15-1 | Molecular Weight | 223.22700 |
|---|
| Density | 1.316g/cm3 | Boiling Point | 413.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.5ºC |
|---|
Names
| Name | 4-nitrophenanthrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.316g/cm3 |
|---|
| Boiling Point | 413.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9NO2 |
|---|
| Molecular Weight | 223.22700 |
|---|
| Flash Point | 207.5ºC |
|---|
| Exact Mass | 223.06300 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 4.42440 |
|---|
| Index of Refraction | 1.741 |
|---|
| InChIKey | JMKUZZRDJVZRQZ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc2ccc3ccccc3c12 |
|---|
Synonyms
| 4-Nitro-phenanthren |
| 4-Nitro-phenanthren,x-Nitro-phenanthren vom F:73-75grad |
| Phenanthrene,4-nitro |
| 4-nitro-phenanthrene |
