Introduction：Basic information about CAS 347-63-7|3-(3-fluoro-4-methoxybenzoyl)propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-fluoro-4-methoxybenzoyl)propionic acid |
|---|
| CAS Number | 347-63-7 | Molecular Weight | 226.20100 |
|---|
| Density | 1.279g/cm3 | Boiling Point | 422.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H11FO4 | Melting Point | 167-171 °C(lit.) |
|---|
| MSDS | / | Flash Point | 209.4ºC |
|---|
Names
| Name | 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.279g/cm3 |
|---|
| Boiling Point | 422.6ºC at 760mmHg |
|---|
| Melting Point | 167-171 °C(lit.) |
|---|
| Molecular Formula | C11H11FO4 |
|---|
| Molecular Weight | 226.20100 |
|---|
| Flash Point | 209.4ºC |
|---|
| Exact Mass | 226.06400 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 1.88180 |
|---|
| InChIKey | SNRFVYKMDZSFED-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)CCC(=O)O)cc1F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-(3-fluoro-4-methoxybenzoyl)propionic acid |
| MFCD00020538 |
| 3-(3-fluoro-para-anisoyl)-propionic acid |
| EINECS 206-474-7 |
