Introduction：Basic information about CAS 93047-39-3|Etanterol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Etanterol |
|---|
| CAS Number | 93047-39-3 | Molecular Weight | 316.39500 |
|---|
| Density | 1.243g/cm3 | Boiling Point | 583.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Boiling Point | 583.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24N2O3 |
|---|
| Molecular Weight | 316.39500 |
|---|
| Flash Point | 306.7ºC |
|---|
| Exact Mass | 316.17900 |
|---|
| PSA | 98.74000 |
|---|
| LogP | 2.69300 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | BMMHZTIQZODVHZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(Cc1ccc(O)cc1)NCC(O)c1cc(N)cc(CO)c1 |
|---|
