Introduction：Basic information about CAS 330-17-6|4-(trifluoromethylthio)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethylthio)benzoic acid |
|---|
| CAS Number | 330-17-6 | Molecular Weight | 222.18400 |
|---|
| Density | 1.5 g/cm3 | Boiling Point | 227.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5F3O2S | Melting Point | 159.5-162.5 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 91.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-(trifluoromethylsulfanyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5 g/cm3 |
|---|
| Boiling Point | 227.6ºC at 760 mmHg |
|---|
| Melting Point | 159.5-162.5 °C(lit.) |
|---|
| Molecular Formula | C8H5F3O2S |
|---|
| Molecular Weight | 222.18400 |
|---|
| Flash Point | 91.4ºC |
|---|
| Exact Mass | 221.99600 |
|---|
| PSA | 62.60000 |
|---|
| LogP | 2.99670 |
|---|
| InChIKey | UMOGQQWVQUQTQA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(SC(F)(F)F)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD00040906 |
| 4-((Trifluoromethyl)thio)benzoic acid |
| 4-Trifluoromethylsulfanyl-benzoic acid |
| 4-(TrifluoroMethylthio)benzoic Acid |
| 4-Trifluormercapto-methyl-benzoesaeure |
| p-Trifluormethylmercapto-benzoesaeure |
