Introduction：Basic information about CAS 6380-05-8|N-(2-chlorophenyl)-4-methyl-benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2-chlorophenyl)-4-methyl-benzenesulfonamide |
|---|
| CAS Number | 6380-05-8 | Molecular Weight | 281.75800 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 450.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12ClNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.3ºC |
|---|
Names
| Name | N-(2-chlorophenyl)-4-methylbenzenesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 450.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12ClNO2S |
|---|
| Molecular Weight | 281.75800 |
|---|
| Flash Point | 226.3ºC |
|---|
| Exact Mass | 281.02800 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 4.60300 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | GOEWZPICEGNTPR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1 |
|---|
