Introduction：Basic information about CAS 7471-33-2|2-(4-propan-2-ylbenzoyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-propan-2-ylbenzoyl)benzoic acid |
|---|
| CAS Number | 7471-33-2 | Molecular Weight | 268.30700 |
|---|
| Density | 1.165g/cm3 | Boiling Point | 456.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 244.2ºC |
|---|
Names
| Name | 2-(4-propan-2-ylbenzoyl)benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.165g/cm3 |
|---|
| Boiling Point | 456.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16O3 |
|---|
| Molecular Weight | 268.30700 |
|---|
| Flash Point | 244.2ºC |
|---|
| Exact Mass | 268.11000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.73920 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | NNTBAICEOKELNU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(C(=O)c2ccccc2C(=O)O)cc1 |
|---|
