Introduction:Basic information about CAS 740836-61-7|Methyl 7-(benzyloxy)-8-bromo-4-methoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 7-(benzyloxy)-8-bromo-4-methoxy-2-naphthoate |
|---|
| CAS Number | 740836-61-7 | Molecular Weight | 401.25100 |
|---|
| Density | 1.401g/cm3 | Boiling Point | 523.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.6ºC |
|---|
Names
| Name | Methyl 7-(benzyloxy)-8-bromo-4-methoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.401g/cm3 |
|---|
| Boiling Point | 523.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17BrO4 |
|---|
| Molecular Weight | 401.25100 |
|---|
| Flash Point | 270.6ºC |
|---|
| Exact Mass | 400.03100 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 4.97650 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | REPIYDJZXZAWTJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2ccc(OCc3ccccc3)c(Br)c2c1 |
|---|