Introduction:Basic information about CAS 828940-58-5|Ethyl 5-(benzyloxy)-4,7,8-trimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5-(benzyloxy)-4,7,8-trimethoxy-2-naphthoate |
|---|
| CAS Number | 828940-58-5 | Molecular Weight | 396.43300 |
|---|
| Density | 1.184g/cm3 | Boiling Point | 552.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240ºC |
|---|
Names
| Name | Ethyl 5-(benzyloxy)-4,7,8-trimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.184g/cm3 |
|---|
| Boiling Point | 552.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24O6 |
|---|
| Molecular Weight | 396.43300 |
|---|
| Flash Point | 240ºC |
|---|
| Exact Mass | 396.15700 |
|---|
| PSA | 63.22000 |
|---|
| LogP | 4.62130 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | STJQJKLWOHWDEY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC)c2c(OCc3ccccc3)cc(OC)c(OC)c2c1 |
|---|