Introduction：Basic information about CAS 926658-49-3|Ethyl 4-acetoxy-6-(dimethylamino)-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-6-(dimethylamino)-2-naphthoate |
|---|
| CAS Number | 926658-49-3 | Molecular Weight | 301.33700 |
|---|
| Density | 1.188g/cm3 | Boiling Point | 462.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.8ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-6-(dimethylamino)-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.188g/cm3 |
|---|
| Boiling Point | 462.9ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19NO4 |
|---|
| Molecular Weight | 301.33700 |
|---|
| Flash Point | 233.8ºC |
|---|
| Exact Mass | 301.13100 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 3.00780 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | RHSKIRGCEGVXHN-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2cc(N(C)C)ccc2c1 |
|---|
