Introduction:Basic information about CAS 5803-58-7|2,5,7-TRIMETHOXY-[1,4]NAPHTHOQUINONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5,7-TRIMETHOXY-[1,4]NAPHTHOQUINONE |
|---|
| CAS Number | 5803-58-7 | Molecular Weight | 248.23100 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 469.486ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.925ºC |
|---|
Names
| Name | 2,5,7-trimethoxynaphthalene-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 469.486ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 |
|---|
| Molecular Weight | 248.23100 |
|---|
| Flash Point | 212.925ºC |
|---|
| Exact Mass | 248.06800 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 1.61310 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | PFRXZICTHLYYGK-UHFFFAOYSA-N |
|---|
| SMILES | COC1=CC(=O)c2c(OC)cc(OC)cc2C1=O |
|---|
Synonyms
| 2,5,7-Trimethoxynaphthochinon |
| 3,6,8-trimethoxy-1,4-naphthoquinone |
| 2,5,7-trimethoxy-1,4-naphthoquinone |